Phorate D10 100 µg/mL in Acetone
| Catalog Number |
ACM1219805454-2 |
| CAS |
1219805-45-4 |
| Structure |
 |
| IUPAC Name |
ethylsulfanylmethylsulfanyl-bis(1,1,2,2,2-pentadeuterioethoxy)-sulfanylidene-?^{5}-phosphane |
| Molecular Weight |
270.44 |
| Molecular Formula |
C7D10H7O2PS3 |
| Canonical SMILES |
[2H]C([2H])([2H])C([2H])([2H])OP(=S)(OC([2H])([2H])C([2H])([2H])[2H])SCSCC |
| InChI |
InChI=1S/C7H17O2PS3/c1-4-8-10(11,9-5-2)13-7-12-6-3/h4-7H2,1-3H3/i1D3,2D3,4D2,5D2 |
| Storage |
+20 °C |
| Accurate Mass |
270.0756 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
