| Catalog Number |
ACM1219794690-1 |
| CAS |
1219794-69-0 |
| Structure |
 |
| Description |
Phenylbutazone(diphenyl-d10) is the deuterium labeled Phenylbutazone. Phenylbutazone is an efficient reducing cofactor for the peroxidase activity of prostaglandin H synthase (PHS). Phenylbutazone, a hepatotoxin, is a nonsteroidal anti-inflammatory agent (NSAID). Phenylbutazone induces muscle blind-like protein 1 (MBNL1) expression and has the potential for ankylosing spondylitis research. |
| Synonyms |
4-Butyl-1,2-diphenyl-3,5-pyrazolidinedione |
| Molecular Weight |
318.44 |
| Molecular Formula |
C19H10D10N2O2 |
| Canonical SMILES |
O=C1N(N(C(=O)C1CCCC)C2=C(C(=C(C(=C2[2H])[2H])[2H])[2H])[2H])C3=C(C(=C(C(=C3[2H])[2H])[2H])[2H])[2H] |
| Appearance |
White to off-white solid |
| Application |
Environmental Analysis, Synthetic Intermediates, Pharmaceuticals and Personal Care Products (PPCPs), Priority Pollutants |
| Storage |
Keep container closed when no tin use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances |
| EC Number |
200-029-0 (Unlabeled) |
| Type |
Labeled Reference Standards |
| CAS (Unlabeled) |
50-33-9 |
