Phenacetin (Ethoxy-1-13C)
| Catalog Number |
ACM72156720-1 |
| CAS |
72156-72-0 |
| Structure |
 |
| Synonyms |
Phenacetin-ethoxy-[1-13C]; [Ethoxy-1-13C]-phenacetin |
| IUPAC Name |
N-(4-(1-13C)ethoxyphenyl)acetamide |
| Molecular Weight |
180.21 |
| Molecular Formula |
13CC9H13NO2 |
| InChI |
InChI=1S/C10H13NO2/c1-3-13-10-6-4-9(5-7-10)11-8(2)12/h4-7H,3H2,1-2H3,(H,11,12)/i3+1 |
| InChI Key |
CPJSUEIXXCENMM-LBPDFUHNSA-N |
| Melting Point |
134-136 °C (273-277 °F) |
| Purity |
98% |
| Appearance |
White crystalline solid |
| Chemical Formula |
CH3CONHC6H4O*CH2CH3 |
| Isomeric SMILES |
C[13CH2]OC1=CC=C(C=C1)NC(=O)C |
| Isotopic Enrichment |
99 atom % 13C |
| Stability |
Stable if stored under recommended conditions. |
| Unlabeled CAS |
62-44-2 |
| Unlabeled Synonyms |
N-(4-Ethoxyphenyl)acetamide; 1-Acetyl-p-phenetidin; Acetophenetidin; 4'-Ethoxyacetanilide; p-Acetophenetidide |
Please kindly note that our products and services are for research use only.
