| Catalog Number |
ACM1794760192 |
| CAS |
1794760-19-2 |
| Structure |
 |
| Description |
Permethrin-d5 (NRDC-143-d5) is deuterium-labeled permethrin. Permethrin, also known as permethrin, permethrin, and permethrin, is mainly used as an insecticide. It has strong contact and stomach poisoning effects, strong knockdown power, and fast insecticidal speed. specialty. |
| Molecular Weight |
396.32 |
| Molecular Formula |
C21H15D5Cl2O3 |
| Canonical SMILES |
C(=C(Cl)Cl)C1C(C(OCC2=CC(OC3=C(C(=C(C(=C3[2H])[2H])[2H])[2H])[2H])=CC=C2)=O)C1(C)C |
| Purity |
≥98.0% |
| Appearance |
Solid |
| Storage |
Powder: -20℃, 3 years; 4℃, 2 years. In solvent: -80℃, 6 months; -20℃, 1 month. |
| Shipping |
Room temperature in continental US; may vary elsewhere. |
