| Catalog Number |
ACM115871506 |
| CAS |
115871-50-6 |
| Structure |
 |
| Synonyms |
Valeric acid-D9 |
| IUPAC Name |
2,2,3,3,4,4,5,5,5-nonadeuteriopentanoic acid |
| Molecular Weight |
111.19 |
| Molecular Formula |
C5HD9O2 |
| Canonical SMILES |
CCCCC(=O)O |
| InChI |
InChI=1S/C5H10O2/c1-2-3-4-5(6)7/h2-4H2,1H3,(H,6,7)/i1D3,2D2,3D2,4D2 |
| InChI Key |
NQPDZGIKBAWPEJ-YNSOAAEFSA-N |
| Boiling Point |
185 °C (lit.) |
| Melting Point |
-20-18 °C (lit.) |
| Flash Point |
192 °F |
| Purity |
98 atom % D |
| Density |
1.022 g/mL at 25 °C |
| Chemical Formula |
CD3(CD2)3COOH |
| Exact Mass |
111.12500 |
| Isomeric SMILES |
[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)O |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
109-52-4 |
| Unlabeled Synonyms |
Valeric acid |
