| Catalog Number |
ACM83741768 |
| CAS |
83741-76-8 |
| Structure |
 |
| Synonyms |
PENTANOIC-5,5,5-D3 ACID;Pentanoic-5,5,5-D3 |
| IUPAC Name |
5,5,5-trideuteriopentanoic acid |
| Molecular Weight |
105.15 |
| Molecular Formula |
C5H7D3O2 |
| Canonical SMILES |
CCCCC(=O)O |
| InChI |
InChI=1S/C5H10O2/c1-2-3-4-5(6)7/h2-4H2,1H3,(H,6,7)/i1D3 |
| InChI Key |
NQPDZGIKBAWPEJ-FIBGUPNXSA-N |
| Purity |
99 atom % D |
| Chemical Formula |
CD3(CH2)3COOH |
| Exact Mass |
105.08700 |
| Isomeric SMILES |
[2H]C([2H])([2H])CCCC(=O)O |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
109-52-4 |
| Unlabeled Synonyms |
Valeric acid |
