Pentanoic-2,2,3,3-d4 acid
| Catalog Number |
ACM1219804713-1 |
| CAS |
1219804-71-3 |
| Structure |
 |
| Synonyms |
Pentanoic-d4 acid |
| IUPAC Name |
2,2,3,3-tetradeuteriopentanoic acid |
| Molecular Weight |
106.16 |
| Molecular Formula |
C5H6D4O2 |
| InChI |
InChI=1S/C5H10O2/c1-2-3-4-5(6)7/h2-4H2,1H3,(H,6,7)/i3D2,4D2 |
| InChI Key |
NQPDZGIKBAWPEJ-KHORGVISSA-N |
| Chemical Formula |
CH3CH2CD2CD2COOH |
| Isomeric SMILES |
[2H]C([2H])(CC)C([2H])([2H])C(=O)O |
| Isotopic Enrichment |
99 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
109-52-4 |
| Unlabeled Synonyms |
Valeric acid |
Please kindly note that our products and services are for research use only.
