Pentadecanoic-15,15,15-d3 acid
| Catalog Number |
ACM352431404 |
| CAS |
352431-40-4 |
| Structure |
 |
| Synonyms |
Pentadecylic acid(D3) |
| IUPAC Name |
15,15,15-trideuteriopentadecanoic acid |
| Molecular Weight |
245.42 |
| Molecular Formula |
C15H27D3O2 |
| Canonical SMILES |
CCCCCCCCCCCCCCC(=O)O |
| InChI |
InChI=1S/C15H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17/h2-14H2,1H3,(H,16,17)/i1D3 |
| InChI Key |
WQEPLUUGTLDZJY-FIBGUPNXSA-N |
| Purity |
99 atom % D |
| Chemical Formula |
CD3(CH2)13COOH |
| Exact Mass |
245.24300 |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])CCCCCCCCCCCCCC(=O)O |
| Isotopic Enrichment |
99 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
1002-84-2 |
| Unlabeled Synonyms |
Pentadecylic acid |
Please kindly note that our products and services are for research use only.
