p-Tolualdehyde-2,3,5,6-d4
| Catalog Number |
ACM1219804075 |
| CAS |
1219804-07-5 |
| IUPAC Name |
2,3,5,6-tetradeuterio-4-methylbenzaldehyde |
| Molecular Weight |
124.18 |
| Molecular Formula |
C8H4D4O |
| InChI |
InChI=1S/C8H8O/c1-7-2-4-8(6-9)5-3-7/h2-6H,1H3/i2D,3D,4D,5D |
| InChI Key |
FXLOVSHXALFLKQ-QFFDRWTDSA-N |
| Purity |
96% |
| Chemical Formula |
CH3C6D4CHO |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C1=C(C(=C(C(=C1C)[2H])[2H])C=O)[2H] |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
104-87-0 |
| Unlabeled Synonyms |
4-Methylbenzaldehyde |
Please kindly note that our products and services are for research use only.
