Oxamyl D3 (S-methyl D3) 100 µg/mL in Methyl-tert-butyl ether
| Catalog Number |
ACM2375621228 |
| CAS |
2375621-22-8 |
| Structure |
 |
| Synonyms |
Oxamyl D3 (2-methyl-D3) |
| IUPAC Name |
trideuteriomethyl (1E)-2-(dimethylamino)-N-(methylcarbamoyloxy)-2-oxoethanimidothioate |
| Molecular Weight |
222.28 |
| Molecular Formula |
C7D3H10N3O3S |
| Canonical SMILES |
[2H]C([2H])([2H])S\C(=N\OC(=O)NC)\C(=O)N(C)C |
| InChI |
InChI=1S/C7H13N3O3S/c1-8-7(12)13-9-5(14-4)6(11)10(2)3/h1-4H3,(H,8,12)/b9-5+/i4D3 |
| Storage |
+20 °C |
| Accurate Mass |
222.0866 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
