Omethoate D6 (dimethyl D6) 100 µg/mL in Acetone
| Catalog Number |
ACM1219804928-2 |
| CAS |
1219804-92-8 |
| Structure |
 |
| IUPAC Name |
2-[bis(trideuteriomethoxy)phosphorylsulfanyl]-N-methylacetamide |
| Molecular Weight |
219.23 |
| Molecular Formula |
C5D6H6NO4PS |
| Canonical SMILES |
[2H]C([2H])([2H])OP(=O)(OC([2H])([2H])[2H])SCC(=O)NC |
| InChI |
InChI=1S/C5H12NO4PS/c1-6-5(7)4-12-11(8,9-2)10-3/h4H2,1-3H3,(H,6,7)/i2D3,3D3 |
| Storage |
+20 °C |
| Accurate Mass |
219.0601 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
