Octanoic acid (1-13C) microbiological/pyrogen tested
| Catalog Number |
ACM59669168-2 |
| CAS |
59669-16-8 |
| Structure |
 |
| Synonyms |
Octanoic acid-1-13C; Octanoic acid 1-C-13 |
| IUPAC Name |
(1-13C)octanoic acid |
| Molecular Weight |
145.20 |
| Molecular Formula |
13CC7H16O2 |
| InChI |
InChI=1S/C8H16O2/c1-2-3-4-5-6-7-8(9)10/h2-7H2,1H3,(H,9,10)/i8+1 |
| InChI Key |
WWZKQHOCKIZLMA-VJJZLTLGSA-N |
| Boiling Point |
237 °C (459 °F) (lit.) |
| Melting Point |
15-17 °C (59-63°F) (lit.) |
| Flash Point |
>110 °C (>230 °F)-closed cup |
| Purity |
98% |
| Density |
0.91 g/mL at 25 °C (77 °F) |
| Appearance |
Light yellow viscous liquid |
| Chemical Formula |
CH3(CH2)6*COOH |
| Isomeric SMILES |
CCCCCCC[13C](=O)O |
| Isotopic Enrichment |
99 atom % 13C |
| pH |
3.5 at 0.5 g/L |
| Stability |
Stable if stored under recommended conditions. |
| Unlabeled CAS |
124-07-2 |
| Unlabeled Synonyms |
Caprylic acid; acid C8 |
Please kindly note that our products and services are for research use only.
