| Catalog Number |
ACM156779054 |
| CAS |
156779-05-4 |
| Structure |
 |
| Synonyms |
Octanoic acid-d3 |
| IUPAC Name |
8,8,8-trideuteriooctanoic acid |
| Molecular Weight |
147.23 |
| Molecular Formula |
C8H13D3O2 |
| InChI |
InChI=1S/C8H16O2/c1-2-3-4-5-6-7-8(9)10/h2-7H2,1H3,(H,9,10)/i1D3 |
| InChI Key |
WWZKQHOCKIZLMA-FIBGUPNXSA-N |
| Boiling Point |
237 °C (lit.) |
| Melting Point |
16 °C (lit.) |
| Flash Point |
110 °C |
| Purity |
99 atom % D |
| Density |
0.929 g/mL at 25 °C |
| Chemical Formula |
CD3(CH2)6COOH |
| Hazards |
Corrosive |
| Isomeric SMILES |
[2H]C([2H])([2H])CCCCCCC(=O)O |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
124-07-2 |
| Unlabeled Synonyms |
Caprylic acid |
