| Catalog Number |
ACM64118361 |
| CAS |
64118-36-1 |
| Structure |
 |
| Synonyms |
Octanoic-d2 acid; Octanoic acid-d2 |
| IUPAC Name |
2,2-dideuteriooctanoic acid |
| Molecular Weight |
146.23 |
| Molecular Formula |
C8H14D2O2 |
| InChI |
InChI=1S/C8H16O2/c1-2-3-4-5-6-7-8(9)10/h2-7H2,1H3,(H,9,10)/i7D2 |
| InChI Key |
WWZKQHOCKIZLMA-RJSZUWSASA-N |
| Purity |
98 atom % D |
| Chemical Formula |
CH3(CH2)5CD2COOH |
| Hazards |
Corrosive |
| Isomeric SMILES |
[2H]C([2H])(CCCCCC)C(=O)O |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
124-07-2 |
| Unlabeled Synonyms |
Caprylic acid |
