| Catalog Number |
ACM62163397 |
| CAS |
62163-39-7 |
| Structure |
 |
| Synonyms |
Stearic acid(D3); 18,18,18-Trideuteriooctadecanoic acid; Stearic acid-18,18,18-D3 |
| IUPAC Name |
18,18,18-trideuteriooctadecanoic acid |
| Molecular Weight |
287.50 |
| Molecular Formula |
C18H33D3O2 |
| InChI |
InChI=1S/C18H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2-17H2,1H3,(H,19,20)/i1D3 |
| InChI Key |
QIQXTHQIDYTFRH-FIBGUPNXSA-N |
| Boiling Point |
361 °C (lit.) |
| Melting Point |
68-70 °C (lit.) |
| Flash Point |
113 °C |
| Purity |
99 atom % D |
| Chemical Formula |
CD3(CH2)16COOH |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])CCCCCCCCCCCCCCCCC(=O)O |
| Isotopic Enrichment |
99 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
57-11-4 |
| Unlabeled Synonyms |
Stearic acid |
