Catalog Number |
ACM951209599-1 |
CAS |
951209-59-9 |
Structure |
|
Synonyms |
Stearic acid D7 |
IUPAC Name |
16,16,17,17,18,18,18-heptadeuteriooctadecanoic acid |
Molecular Weight |
291.52 |
Molecular Formula |
C18H29D7O2 |
InChI |
InChI=1S/C18H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2-17H2,1H3,(H,19,20)/i1D3,2D2,3D2 |
InChI Key |
QIQXTHQIDYTFRH-NCKGIQLSSA-N |
Chemical Formula |
CD3(CD2)2(CH2)14COOH |
Hazards |
Non-hazardous for transport. |
Isomeric SMILES |
[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])CCCCCCCCCCCCCCC(=O)O |
Isotopic Enrichment |
98 atom % D |
Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
Storage Conditions |
Store at room temperature |
Unlabeled CAS |
57-11-4 |
Unlabeled Synonyms |
Stearic acid |