| Catalog Number |
ACM62163411 |
| CAS |
62163-41-1 |
| Structure |
 |
| Synonyms |
(12)D1-Octadecanoic acid |
| IUPAC Name |
12-deuteriooctadecanoic acid |
| Molecular Weight |
285.49 |
| Molecular Formula |
C18H35DO2 |
| InChI |
InChI=1S/C18H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2-17H2,1H3,(H,19,20)/i7D |
| InChI Key |
QIQXTHQIDYTFRH-WHRKIXHSSA-N |
| Purity |
99 atom % D |
| Chemical Formula |
CH3(CH2)5CHD(CH2)10COOH |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C(CCCCCC)CCCCCCCCCCC(=O)O |
| Isotopic Enrichment |
99 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
57-11-4 |
| Unlabeled Synonyms |
Stearic acid |
