O-Desmethyl Indomethacin-d4
| Catalog Number |
ACM1189916559 |
| CAS |
1189916-55-9 |
| Structure |
 |
| Synonyms |
1-(4-Chlorobenzoyl-d4)-5-hydroxy-2-methyl-1H-indole-3-acetic Acid, 5-Hydroxy- |
| IUPAC Name |
2-(1-(4-chlorobenzoyl-2,3,5,6-d4)-5-hydroxy-2-methyl-1H-indol-3-yl)acetic acid |
| Molecular Weight |
347.79 |
| Molecular Formula |
C18H10D4ClNO4 |
| Canonical SMILES |
O=C(C1=C([2H])C([2H])=C(C([2H])=C1[2H])Cl)N2C3=CC=C(O)C=C3C(CC(O)=O)=C2C |
| InChI |
InChI=1S/C18H14ClNO4/c1-10-14(9-17(22)23)15-8-13(21)6-7-16(15)20(10)18(24)11-2-4-12(19)5-3-11/h2-8,21H,9H2,1H3,(H,22,23)/i2D,3D,4D,5D |
| Storage |
-20 °C |
| Accurate Mass |
347.09 |
| API Family |
Indomethacin |
| Format |
Neat |
| Shipping Temperature |
Room temperature |
| SIL Type |
Deuterium |
| Unlabeled CAS |
2504-32-7 |
Please kindly note that our products and services are for research use only.
