o-Cresol-d3 (methyl-d3) (99 atom % D, min 98% Chemical Purity)
| Catalog Number |
ACM70837273-1 |
| CAS |
70837-27-3 |
| Structure |
 |
| Synonyms |
Phenol, 2-(methyl-d3)- (9CI, ACI), 2-(Methyl-d3)phenol (ACI), o-Cresol-d3 (methyl-d3), 2-Methylphenol-D3 (methyl-D3) |
| IUPAC Name |
2-(methyl-d3)phenol |
| Molecular Weight |
111.16 |
| Molecular Formula |
C7H5D3O |
| Canonical SMILES |
OC1=CC=CC=C1C([2H])([2H])[2H] |
| InChI |
InChI=1S/C7H8O/c1-6-4-2-3-5-7(6)8/h2-5,8H,1H3/i1D3 |
| Accurate Mass |
111.08 |
| Format |
Neat |
| SIL Type |
Deuterium |
| Unlabeled CAS |
95-48-7 |
Please kindly note that our products and services are for research use only.
