| Catalog Number |
ACM1015856571-1 |
| CAS |
1015856-57-1 |
| Structure |
 |
| Description |
Norfloxacin-d5 is deuterium-labeled norfloxacin. Norfloxacin, also known as norfloxacin, is a third-generation quinolone antibacterial drug that blocks the action of DNA gyrase (DNA Gyrase) of pathogenic bacteria in the digestive tract, hinders bacterial DNA replication, and has an inhibitory effect on bacteria. Commonly used medicine for treating enteritis and dysentery. |
| Molecular Weight |
324.36 |
| Molecular Formula |
C16H13D5FN3O3 |
| Canonical SMILES |
O=C(C1=CN(C([2H])([2H])C([2H])([2H])[2H])C2=C(C=C(F)C(N3CCNCC3)=C2)C1=O)O |
| Purity |
≥99.0% |
| Appearance |
Solid |
| Storage |
Powder: -20℃, 3 years; 4℃, 2 years. In solvent: -80℃, 6 months; -20℃, 1 month. |
| Shipping |
Room temperature in continental US; may vary elsewhere. |
