Catalog Number |
ACM2376036052 |
CAS |
2376036-05-2 |
Synonyms |
Norethindrone-d6 |
IUPAC Name |
(8R,9S,10R,13S,14S,17R)-2,2,4,6,6,10-hexadeuterio-17-ethynyl-17-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-one |
Molecular Weight |
304.46 |
Molecular Formula |
C20H20D6O2 |
InChI |
InChI=1S/C20H26O2/c1-3-20(22)11-9-18-17-6-4-13-12-14(21)5-7-15(13)16(17)8-10-19(18,20)2/h1,12,15-18,22H,4-11H2,2H3/t15-,16+,17+,18-,19-,20-/m0/s1/i4D2,5D2,12D,15D |
InChI Key |
VIKNJXKGJWUCNN-CWFXCRECSA-N |
Hazards |
Non-hazardous for transport. |
Isomeric SMILES |
[2H]C1=C2[C@](CC(C1=O)([2H])[2H])([C@H]3CC[C@]4([C@H]([C@@H]3CC2([2H])[2H])CC[C@]4(C#C)O)C)[2H] |
Isotopic Enrichment |
98 atom % D |
Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
Storage Conditions |
Store at room temperature |
CAS (Unlabeled) |
68-22-4 |
Synonyms (Unlabeled) |
4-Estren-17α-ethynyl-17β-ol-3 one; 17α-Ethynyl-19-nortestosterone; Norethisterone |