| Catalog Number |
ACM358730957 |
| CAS |
358730-95-7 |
| Structure |
 |
| Description |
4-Nonylphenol-d5 is the deuterium labeled 4-Nonylphenol. 4-Nonylphenol, a major degradation product of Nonylphenol ethoxylates (NPEOs), is a persistent organic pollutant with endocrine-disrupting properties and exerts estrogenic activity. |
| Synonyms |
4-n-Nonylphenol-2,3,5,6-d4,OD |
| Molecular Weight |
225.38 |
| Molecular Formula |
C15H19D5O |
| Canonical SMILES |
[2H]OC1=C([2H])C([2H])=C(CCCCCCCCC)C([2H])=C1[2H] |
| Purity |
0.9896 |
| Appearance |
Solid |
| Storage |
Powder: -20℃, 3 years; 4℃, 2 years. In solvent: -80℃, 6 months; -20℃, 1 month. |
| Shipping |
Room temperature in continental US; may vary elsewhere. |
