| Catalog Number |
ACM134646278 |
| CAS |
134646-27-8 |
| Structure |
 |
| Synonyms |
9,9,9-Trideuteriononanoic acid |
| IUPAC Name |
9,9,9-trideuteriononanoic acid |
| Molecular Weight |
161.26 |
| Molecular Formula |
C9H15D3O2 |
| InChI |
InChI=1S/C9H18O2/c1-2-3-4-5-6-7-8-9(10)11/h2-8H2,1H3,(H,10,11)/i1D3 |
| InChI Key |
FBUKVWPVBMHYJY-FIBGUPNXSA-N |
| Purity |
99 atom % D |
| Chemical Formula |
CD3(CH2)7COOH |
| Isomeric SMILES |
[2H]C([2H])([2H])CCCCCCCC(=O)O |
| Isotopic Enrichment |
99 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
112-05-0 |
| Unlabeled Synonyms |
Pelargonic acid |
