| Catalog Number |
ACM1219795273-1 |
| CAS |
1219795-27-3 |
| IUPAC Name |
6,6,7,7-tetradeuteriononanoic acid |
| Molecular Weight |
162.26 |
| Molecular Formula |
C9H14D4O2 |
| InChI |
InChI=1S/C9H18O2/c1-2-3-4-5-6-7-8-9(10)11/h2-8H2,1H3,(H,10,11)/i3D2,4D2 |
| InChI Key |
FBUKVWPVBMHYJY-KHORGVISSA-N |
| Chemical Formula |
CH3CH2(CD2)2(CH2)4COOH |
| Hazards |
Corrosive |
| Isomeric SMILES |
[2H]C([2H])(CC)C([2H])([2H])CCCCC(=O)O |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
112-05-0 |
| Unlabeled Synonyms |
Pelargonic acid |
