| Catalog Number |
ACM1466552362 |
| CAS |
1466552-36-2 |
| Synonyms |
[2H18]-Nonanal |
| IUPAC Name |
1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-octadecadeuteriononan-1-one |
| Molecular Weight |
160.35 |
| Molecular Formula |
C9D18O |
| InChI |
InChI=1S/C9H18O/c1-2-3-4-5-6-7-8-9-10/h9H,2-8H2,1H3/i1D3,2D2,3D2,4D2,5D2,6D2,7D2,8D2,9D |
| InChI Key |
GYHFUZHODSMOHU-PBYHGZINSA-N |
| Purity |
96% |
| Chemical Formula |
CD3(CD2)7CDO |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C(=O)C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H] |
| Isotopic Enrichment |
99 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
124-19-6 |
| Unlabeled Synonyms |
Nonaldehyde; Nonyl aldehyde; Pelargonaldehyde |
