4-Nitrophenol D4 100 µg/mL in Acetone
| Catalog Number |
ACM93951792-1 |
| CAS |
93951-79-2 |
| Structure |
 |
| Synonyms |
4-Nitrophenol-2,3,5,6-D4 |
| IUPAC Name |
2,3,5,6-tetradeuterio-4-nitrophenol |
| Molecular Weight |
143.13 |
| Molecular Formula |
C6D4HNO3 |
| Canonical SMILES |
[2H]c1c([2H])c(c([2H])c([2H])c1O)[N+](=O)[O-] |
| InChI |
InChI=1S/C6H5NO3/c8-6-3-1-5(2-4-6)7(9)10/h1-4,8H/i1D,2D,3D,4D |
| Storage |
+20 °C |
| Accurate Mass |
143.0521 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
| Unlabeled CAS |
100-02-7 |
Please kindly note that our products and services are for research use only.
