| Catalog Number |
ACM78832618-1 |
| CAS |
78832-61-8 |
| Structure |
 |
| Synonyms |
2-?Naphthalen-?1,?3,?4,?5,?6,?7,?8-?d7-?ol-?d |
| IUPAC Name |
naphthalen-d7-2-ol |
| Molecular Weight |
152.22 |
| Molecular Formula |
C10D8O |
| Canonical SMILES |
[2H]C1=C2C([2H])=C([2H])C([2H])=C([2H])C2=C([2H])C([2H])=C1O[2H] |
| InChI |
InChI=1S/C10H8O/c11-10-6-5-8-3-1-2-4-9(8)7-10/h1-7,11H/i1D,2D,3D,4D,5D,6D,7D/hD |
| InChI Key |
JWAZRIHNYRIHIV-GZORGGLCSA-N |
| Purity |
98 atom % D |
| Accurate Mass |
152.11 |
| Exact Mass |
152.10800 |
| Format |
Neat |
| Functional Group |
Alcohols & Phenols |
| Isotopic Enrichment |
98 atom % D |
| Packaging |
0.25 g
In Stock
0.5 g
In Stock |
| Shipping Hazards |
NON-HAZARDOUS FOR TRANSPORT |
| SIL Type |
Deuterium |
| Stability |
Stable if stored under recommended conditions (see section 7 of SDS). After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
135-19-3 |
