2-Naphthol-1,3,4,5,6,7,8-d7 (98 atom % D, min 98% Chemical Purity)
| Catalog Number |
ACM78832549-1 |
| CAS |
78832-54-9 |
| Structure |
 |
| Synonyms |
2-Naphthalen-1,3,4,5,6,7,8-d7-ol, 2-Naphthol-d7, 2-Naphthol (ring-D7) |
| IUPAC Name |
1,3,4,5,6,7,8-heptadeuterionaphthalen-2-ol |
| Molecular Weight |
151.21 |
| Molecular Formula |
C10D7HO |
| Canonical SMILES |
[2H]c1c([2H])c([2H])c2c([2H])c(O)c([2H])c([2H])c2c1[2H] |
| InChI |
InChI=1S/C10H8O/c11-10-6-5-8-3-1-2-4-9(8)7-10/h1-7,11H/i1D,2D,3D,4D,5D,6D,7D |
| Accurate Mass |
151.1015 |
| Format |
Neat |
| SIL Type |
Deuterium |
| Unlabeled CAS |
135-19-3 |
Please kindly note that our products and services are for research use only.
