| Catalog Number |
ACM349553884 |
| CAS |
349553-88-4 |
| Structure |
 |
| Synonyms |
N-UNDECYL-D23 ALCOHOL |
| IUPAC Name |
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-tricosadeuterioundecan-1-ol |
| Molecular Weight |
195.45 |
| Molecular Formula |
C11HD23O |
| Canonical SMILES |
CCCCCCCCCCCO |
| InChI |
InChI=1S/C11H24O/c1-2-3-4-5-6-7-8-9-10-11-12/h12H,2-11H2,1H3/i1D3,2D2,3D2,4D2,5D2,6D2,7D2,8D2,9D2,10D2,11D2 |
| InChI Key |
KJIOQYGWTQBHNH-SJTGVFOPSA-N |
| Purity |
98 atom % D |
| Chemical Formula |
CD3(CD2)10OH |
| Exact Mass |
195.32700 |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])O |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
112-42-5 |
| Unlabeled Synonyms |
1-Undecanol; Hendecyl alcohol |
