| Catalog Number |
ACM1219803470 |
| CAS |
1219803-47-0 |
| Structure |
 |
| IUPAC Name |
1,1,2,2-tetradeuterioundecan-1-ol |
| Molecular Weight |
176.33 |
| Molecular Formula |
C11H20D4O |
| InChI |
InChI=1S/C11H24O/c1-2-3-4-5-6-7-8-9-10-11-12/h12H,2-11H2,1H3/i10D2,11D2 |
| InChI Key |
KJIOQYGWTQBHNH-MKQHWYKPSA-N |
| Chemical Formula |
CH3(CH2)8CD2CD2OH |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])(CCCCCCCCC)C([2H])([2H])O |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
112-42-5 |
| Unlabeled Synonyms |
1-Undecanol; Hendecyl alcohol |
