| Catalog Number |
ACM95523732-1 |
| CAS |
95523-73-2 |
| Structure |
 |
| Synonyms |
Trimethyl [2H29]tetradecyl ammonium bromide |
| IUPAC Name |
trimethyl(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-nonacosadeuteriotetradecyl)azanium;bromide |
| Molecular Weight |
365.57 |
| Molecular Formula |
C17H9BrD29N |
| InChI |
InChI=1S/C17H38N.BrH/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18(2,3)4;/h5-17H2,1-4H3;1H/q+1;/p-1/i1D3,5D2,6D2,7D2,8D2,9D2,10D2,11D2,12D2,13D2,14D2,15D2,16D2,17D2; |
| InChI Key |
CXRFDZFCGOPDTD-WAQJSBRMSA-M |
| Chemical Formula |
CD3(CD2)13N(CH3)3Br |
| Exact Mass |
364.40079 |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[N+](C)(C)C.[Br-] |
| Isotopic Enrichment |
98 atom % D |
| Monoisotopic Mass |
364.40079 |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Room temperature |
| Unlabeled CAS |
1119-97-7 |
| Unlabeled Synonyms |
Myristyltrimethylammonium bromide |
