N-tau-methylhistamine:2HCl (N-Methyl-D3)
| Catalog Number |
ACM344299496-1 |
| CAS |
344299-49-6 |
| Structure |
 |
| IUPAC Name |
2-[1-(trideuteriomethyl)imidazol-4-yl]ethanamine;dihydrochloride |
| Molecular Weight |
201.11 |
| Molecular Formula |
C6H10D3N3Cl2 |
| InChI |
InChI=1S/C6H11N3.2ClH/c1-9-4-6(2-3-7)8-5-9;;/h4-5H,2-3,7H2,1H3;2*1H/i1D3;; |
| InChI Key |
AGXVEALMQHTMSW-GXXYEPOPSA-N |
| Melting Point |
202-203 °C (396-397 °F) |
| Purity |
98% |
| Appearance |
White powder |
| Isomeric SMILES |
[2H]C([2H])([2H])N1C=C(N=C1)CCN.Cl.Cl |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Two years after receipt. Re-QC after 2 years. |
| Unlabeled CAS |
6481-48-7 |
| Unlabeled Synonyms |
1-Methyl-4-(Beta-aminoethyl)imidazoledihydrochloride |
Please kindly note that our products and services are for research use only.
