| Catalog Number |
ACM1331909013 |
| CAS |
1331909-01-3 |
| Structure |
 |
| Synonyms |
Phenylacetyl-D5 L-glutamine; Phenylacetylglutamine-D5 |
| IUPAC Name |
(2S)-5-amino-5-oxo-2-[[2-(2,3,4,5,6-pentadeuteriophenyl)acetyl]amino]pentanoic acid |
| Molecular Weight |
269.31 |
| Molecular Formula |
C13H11D5N2O4 |
| Canonical SMILES |
[2H]C1=C(C(=C(C(=C1[2H])[2H])CC(=O)N[C@@H](CCC(=O)N)C(=O)O)[2H])[2H] |
| InChI |
InChI=1S/C13H16N2O4/c14-11(16)7-6-10(13(18)19)15-12(17)8-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H2,14,16)(H,15,17)(H,18,19)/t10-/m0/s1/i1D,2D,3D,4D,5D |
| InChI Key |
JFLIEFSWGNOPJJ-CJMNRESHSA-N |
| Melting Point |
52-54 °C |
| Appearance |
Off-white solid |
| Chemical Formula |
H2NCOCH2CH2CH(NHCOCH2C6D5)COOH |
| Hazards |
Non-hazardous for transport. |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
28047-15-6 |
| Unlabeled Synonyms |
Nα-(2-Phenylacetyl)-L-glutamine; Phenylac-L-Gln-OH |
