| Catalog Number |
ACM153336131-1 |
| CAS |
153336-13-1 |
| Structure |
 |
| Synonyms |
1-Octan-D17-Ol |
| IUPAC Name |
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecadeuteriooctan-1-ol |
| Molecular Weight |
147.33 |
| Molecular Formula |
C8HD17O |
| InChI |
InChI=1S/C8H18O/c1-2-3-4-5-6-7-8-9/h9H,2-8H2,1H3/i1D3,2D2,3D2,4D2,5D2,6D2,7D2,8D2 |
| InChI Key |
KBPLFHHGFOOTCA-OISRNESJSA-N |
| Boiling Point |
196 °C (lit.) |
| Melting Point |
-15 °C (lit.) |
| Flash Point |
178 °F |
| Density |
0.936 g/mL at 25 °C |
| Chemical Formula |
CD3(CD2)7OH |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])O |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
111-87-5 |
| Unlabeled Synonyms |
1-Octanol; Capryl alcohol; Caprylic alcohol |
