| Catalog Number |
ACM349553862 |
| CAS |
349553-86-2 |
| Structure |
 |
| Synonyms |
[D19]nonanol |
| IUPAC Name |
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-nonadecadeuteriononan-1-ol |
| Molecular Weight |
163.37 |
| Molecular Formula |
C9HD19O |
| Canonical SMILES |
CCCCCCCCCO |
| InChI |
InChI=1S/C9H20O/c1-2-3-4-5-6-7-8-9-10/h10H,2-9H2,1H3/i1D3,2D2,3D2,4D2,5D2,6D2,7D2,8D2,9D2 |
| InChI Key |
ZWRUINPWMLAQRD-KIJKOTCYSA-N |
| Purity |
98 atom % D |
| Chemical Formula |
CD3(CD2)8OH |
| Exact Mass |
163.27100 |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])O |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
143-08-8 |
| Unlabeled Synonyms |
1-Nonanol |
