N-Nitrosopiperidine-d10 (98 atom % D, min 98% Chemical Purity)
| Catalog Number |
ACM960049212-1 |
| CAS |
960049-21-2 |
| Structure |
 |
| IUPAC Name |
2,2,3,3,4,4,5,5,6,6-decadeuterio-1-nitrosopiperidine |
| Molecular Weight |
124.21 |
| Molecular Formula |
C5D10N2O |
| Canonical SMILES |
[2H]C1([2H])N(N=O)C([2H])([2H])C([2H])([2H])C([2H])([2H])C1([2H])[2H] |
| InChI |
InChI=1S/C5H10N2O/c8-6-7-4-2-1-3-5-7/h1-5H2/i1D2,2D2,3D2,4D2,5D2 |
| Accurate Mass |
124.1421 |
| Format |
Neat |
| SIL Type |
Deuterium |
| Unlabeled CAS |
100-75-4 |
Please kindly note that our products and services are for research use only.
