N-Nitrosodimethyl-1,1,1-d3-amine (99 atom % D, min 98% Chemical Purity)
| Catalog Number |
ACM32745076-1 |
| CAS |
32745-07-6 |
| Structure |
 |
| Synonyms |
Methan-d3-amine, N-methyl-N-nitroso- (9CI), Dimethylamine-1,1,1-d3, N-nitroso- (8CI), N-Nitroso-dimethylamine (methyl-D3), N-Nitroso- N-methyl-d3-methylamine |
| IUPAC Name |
N-methyl-N-(trideuteriomethyl)nitrous amide |
| Molecular Weight |
77.1 |
| Molecular Formula |
C2D3H3N2O |
| Canonical SMILES |
[2H]C([2H])([2H])N(C)N=O |
| InChI |
InChI=1S/C2H6N2O/c1-4(2)3-5/h1-2H3/i1D3 |
| Accurate Mass |
77.0668 |
| Format |
Neat |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
