N-Nitrosobenzylmethyl-d3-amine (99 atom % D, min 98% Chemical Purity)
| Catalog Number |
ACM62845801-1 |
| CAS |
62845-80-1 |
| Structure |
 |
| Synonyms |
Benzenemethanamine, N-(methyl-d3)-N-nitroso- (9CI), N-Nitroso-N-methylbenzylamine-D3 (N-methyl-D3), N-(Methyl-d3)-N-nitrosobenzenemethanamine, N-Nitroso-N-methylbenzylamine-d3, N-Nitroso-N-(methyl-d3)benzylamine |
| IUPAC Name |
N-benzyl-N-(methyl-d3)nitrous amide |
| Molecular Weight |
153.2 |
| Molecular Formula |
C8H7D3N2O |
| Canonical SMILES |
[2H]C([2H])([2H])N(N=O)CC1=CC=CC=C1 |
| InChI |
InChI=1S/C8H10N2O/c1-10(9-11)7-8-5-3-2-4-6-8/h2-6H,7H2,1H3/i1D3 |
| Accurate Mass |
153.1 |
| Format |
Neat |
| SIL Type |
Deuterium |
| Unlabeled CAS |
937-40-6 |
Please kindly note that our products and services are for research use only.
