N-Nitroso-diethylamine D10 1000 µg/mL in Methanol
| Catalog Number |
ACM1219794543-1 |
| CAS |
1219794-54-3 |
| Structure |
 |
| Synonyms |
N-Nitroso-diethylamine D10, N-(Ethyl-d5)-N-nitrosoethan-d5-amine, N-Nitroso-bis(pentadeuterioethyl)amine |
| IUPAC Name |
N,N-bis(1,1,2,2,2-pentadeuterioethyl)nitrous amide |
| Molecular Weight |
112.2 |
| Molecular Formula |
C4D10N2O |
| Canonical SMILES |
[2H]C([2H])([2H])C([2H])([2H])N(N=O)C([2H])([2H])C([2H])([2H])[2H] |
| InChI |
InChI=1S/C4H10N2O/c1-3-6(4-2)5-7/h3-4H2,1-2H3/i1D3,2D3,3D2,4D2 |
| Storage |
+20 °C |
| Accurate Mass |
112.1421 |
| Alternative CAS |
55-18-5 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
