| Catalog Number |
ACM347840033 |
| CAS |
347840-03-3 |
| Structure |
 |
| Synonyms |
N,N-DIMETHYL-D6-GLYCINE HCL;N,N-DIMETHYL-D6-GLYCINE HYDROCHLORIDE;(N-Methlsarcosine HCl);N-Methylsarcosine-dimethyl-d6 hydrochloride |
| IUPAC Name |
2-[bis(trideuteriomethyl)amino]acetic acid;hydrochloride |
| Molecular Weight |
145.62 |
| Molecular Formula |
C4H4ClD6NO2 |
| Canonical SMILES |
[2H]C([2H])([2H])N(CC(=O)O)C([2H])([2H])[2H].Cl |
| InChI |
InChI=1S/C4H9NO2.ClH/c1-5(2)3-4(6)7;/h3H2,1-2H3,(H,6,7);1H/i1D3,2D3; |
| InChI Key |
FKASAVXZZLJTNX-TXHXQZCNSA-N |
| Boiling Point |
190-192 °C (lit.) |
| Purity |
99 atom % D |
| Chemical Formula |
(CD3)2NCH2COOH·HCl |
| Exact Mass |
145.07800 |
| Hazards |
Non-hazardous for transport. |
| Isotopic Enrichment |
99 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| CAS (Unlabeled) |
2491-6-7 |
| Synonyms (Unlabeled) |
N-Methylsarcosine HCl; (Dimethylamino)acetic acid HCl; N-Me-Sar-OH HCl; N-Me2-Gly-OH HCl |
