Catalog Number |
ACM95217144 |
CAS |
95217-14-4 |
Synonyms |
Hexadecyltrimethylammonium bromide-D9 |
IUPAC Name |
hexadecyl-tris(trideuteriomethyl)azanium;bromide |
Molecular Weight |
373.51 |
Molecular Formula |
C19H33D9BrN |
Canonical SMILES |
C1CN=C(N1)NN=CC2=C3C=CC=CC3=C(C4=CC=CC=C42)C=NNC5=NCCN5 |
InChI |
InChI=1S/C19H42N.BrH/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(2,3)4;/h5-19H2,1-4H3;1H/q+1;/p-1/i2D3,3D3,4D3; |
InChI Key |
LZZYPRNAOMGNLH-WWMMTMLWSA-M |
Purity |
99 atom % D |
Chemical Formula |
CH3(CH2)15N(CD3)3Br |
Exact Mass |
372.30655 |
Hazards |
Non-hazardous for transport. |
Isomeric SMILES |
[2H]C([2H])([2H])[N+](CCCCCCCCCCCCCCCC)(C([2H])([2H])[2H])C([2H])([2H])[2H].[Br-] |
Isotopic Enrichment |
99 atom % D |
Monoisotopic Mass |
372.30655 |
Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
Storage Conditions |
Room temperature |
CAS (Unlabeled) |
57-09-0 |
Synonyms (Unlabeled) |
Cetyltrimethylammonium bromide; Palmityltrimethylammonium bromide; Cetrimonium bromide |