| Catalog Number |
ACM347841423-1 |
| CAS |
347841-42-3 |
| Structure |
 |
| Synonyms |
Hexadecyltrimethylammonium bromide-D33 |
| IUPAC Name |
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12-tetracosadeuteriohexadecyl-tris(trideuteriomethyl)azanium;bromide |
| Molecular Weight |
397.65 |
| Molecular Formula |
C19H9BrD33N |
| InChI |
InChI=1S/C19H42N.BrH/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(2,3)4;/h5-19H2,1-4H3;1H/q+1;/p-1/i2D3,3D3,4D3,8D2,9D2,10D2,11D2,12D2,13D2,14D2,15D2,16D2,17D2,18D2,19D2; |
| InChI Key |
LZZYPRNAOMGNLH-NKQDAPHUSA-M |
| Chemical Formula |
CD3(CD2)15N(CH3)3Br |
| Exact Mass |
396.45720 |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])[N+](C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])CCCC.[Br-] |
| Isotopic Enrichment |
98 atom % D |
| Monoisotopic Mass |
396.45720 |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Room temperature |
| Unlabeled CAS |
57-09-0 |
| Unlabeled Synonyms |
Cetyltrimethylammonium bromide; Palmityltrimethylammonium bromide; Cetrimonium bromide |
