| Catalog Number |
ACM284474733-1 |
| CAS |
284474-73-3 |
| Structure |
 |
| Synonyms |
Hexadecyl-d33 alcohol;1-Hexadecan-d33-ol |
| IUPAC Name |
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,16-tritriacontadeuteriohexadecan-1-ol |
| Molecular Weight |
275.65 |
| Molecular Formula |
C16HD33O |
| InChI |
InChI=1S/C16H34O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17/h17H,2-16H2,1H3/i1D3,2D2,3D2,4D2,5D2,6D2,7D2,8D2,9D2,10D2,11D2,12D2,13D2,14D2,15D2,16D2 |
| InChI Key |
BXWNKGSJHAJOGX-TUWMXWROSA-N |
| Boiling Point |
179-181 °C at 10 mmHg (lit.) |
| Melting Point |
54-56 °C (lit.) |
| Density |
0.818 g/mL at 25 °C |
| Chemical Formula |
CD3(CD2)15OH |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])O |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
36653-82-4 |
| Unlabeled Synonyms |
1-Hexadecanol; Palmityl alcohol; Cetyl alcohol |
