n-Hexadecyl-1,1,2,2-d4 hexadecanoate-16,16,16-d3
| Catalog Number |
ACM1398066153 |
| CAS |
1398066-15-3 |
| IUPAC Name |
1,1,2,2-tetradeuteriohexadecyl 16,16,16-trideuteriohexadecanoate |
| Molecular Weight |
487.90 |
| Molecular Formula |
C32H57D7O2 |
| InChI |
InChI=1S/C32H64O2/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-34-32(33)30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h3-31H2,1-2H3/i2D3,29D2,31D2 |
| InChI Key |
PXDJXZJSCPSGGI-LGJOIJPZSA-N |
| Chemical Formula |
CD3(CH2)14COOCD2CD2(CH2)13CH3 |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])CCCCCCCCCCCCCCC(=O)OC([2H])([2H])C([2H])([2H])CCCCCCCCCCCCCC |
| Isotopic Enrichment |
99 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
540-10-3 |
| Unlabeled Synonyms |
n-Hexadecyl palmitate; Palmityl palmitate; Cetyl palmitate |
Please kindly note that our products and services are for research use only.
