| Catalog Number |
ACM194793958-1 |
| CAS |
194793-95-8 |
| Structure |
 |
| IUPAC Name |
1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecadeuterioheptan-1-ol |
| Molecular Weight |
131.29 |
| Molecular Formula |
C7HD15O |
| InChI |
InChI=1S/C7H16O/c1-2-3-4-5-6-7-8/h8H,2-7H2,1H3/i1D3,2D2,3D2,4D2,5D2,6D2,7D2 |
| InChI Key |
BBMCTIGTTCKYKF-PMELWRBQSA-N |
| Chemical Formula |
CD3(CD2)6OH |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])O |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
111-70-6 |
| Unlabeled Synonyms |
n-Heptanol |
