| Catalog Number |
ACM160776830-1 |
| CAS |
160776-83-0 |
| Structure |
 |
| Synonyms |
1-Dodecan-D25-Ol; Dodecyl-D25 alcohol |
| IUPAC Name |
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-pentacosadeuteriododecan-1-ol |
| Molecular Weight |
211.49 |
| Molecular Formula |
C12HD25O |
| InChI |
InChI=1S/C12H26O/c1-2-3-4-5-6-7-8-9-10-11-12-13/h13H,2-12H2,1H3/i1D3,2D2,3D2,4D2,5D2,6D2,7D2,8D2,9D2,10D2,11D2,12D2 |
| InChI Key |
LQZZUXJYWNFBMV-VVZIYBSUSA-N |
| Boiling Point |
260-262 °C (lit.) |
| Melting Point |
22-26 °C (lit.) |
| Flash Point |
>230 °F |
| Density |
0.931 g/mL at 25 °C |
| Chemical Formula |
CD3(CD2)11OH |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])O |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
112-53-8 |
| Unlabeled Synonyms |
1-Dodecanol; Lauryl alcohol |
