N-Despropyl Ropinirole-d3
| Catalog Number |
ACM1215798007 |
| CAS |
1215798-00-7 |
| Structure |
 |
| Synonyms |
4-[2-(Propyl-d3-amino)ethyl]-1,3-dihydro-2H-indol-2-one, 1,3-Dihydro-4-[2-(propyl-d3-amino)ethyl]-2H-indol-2-one, SKF 104557-d3 |
| Molecular Weight |
221.31 |
| Molecular Formula |
C13H15D3N2O |
| Canonical SMILES |
O=C(N1)CC2=C1C=CC=C2CCNCCC([2H])([2H])[2H] |
| Storage |
-20 °C |
| API Family |
Ropinirole |
| Format |
Neat |
| Shipping Temperature |
Room temperature |
| SIL Type |
Deuterium |
| Unlabeled CAS |
106916-16-9 |
Please kindly note that our products and services are for research use only.
