| Catalog Number |
ACM1515861672 |
| CAS |
1515861-67-2 |
| IUPAC Name |
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosadeuteriodecyl(trimethyl)azanium;bromide |
| Molecular Weight |
301.42 |
| Molecular Formula |
C13H9BrD21N |
| InChI |
InChI=1S/C13H30N.BrH/c1-5-6-7-8-9-10-11-12-13-14(2,3)4;/h5-13H2,1-4H3;1H/q+1;/p-1/i1D3,5D2,6D2,7D2,8D2,9D2,10D2,11D2,12D2,13D2; |
| InChI Key |
PLMFYJJFUUUCRZ-KYIJYTBRSA-M |
| Chemical Formula |
CD3(CD2)9N(CH3)3Br |
| EC Number |
218-219-7 |
| Exact Mass |
279.15616 |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[N+](C)(C)C.[Br-] |
| Isotopic Enrichment |
98 atom % D |
| Monoisotopic Mass |
279.15616 |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Room temperature |
| CAS (Unlabeled) |
2082-84-0 |
