n-Decyl-9,9,10,10,10-d5 alcohol
| Catalog Number |
ACM57368000 |
| CAS |
57368-00-0 |
| Structure |
 |
| Synonyms |
n-Decyl-d5 Alcohol |
| IUPAC Name |
9,9,10,10,10-pentadeuteriodecan-1-ol |
| Molecular Weight |
163.31 |
| Molecular Formula |
C10H17D5O |
| Canonical SMILES |
CCCCCCCCCCO |
| InChI |
InChI=1S/C10H22O/c1-2-3-4-5-6-7-8-9-10-11/h11H,2-10H2,1H3/i1D3,2D2 |
| InChI Key |
MWKFXSUHUHTGQN-ZBJDZAJPSA-N |
| Purity |
98 atom % D |
| Chemical Formula |
CD3CD2(CH2)8OH |
| Exact Mass |
163.19800 |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])C([2H])([2H])CCCCCCCCO |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
112-30-1 |
| Unlabeled Synonyms |
1-Decanol; Capric alcohol; Decylic alcohol; Nonylcarbinol |
Please kindly note that our products and services are for research use only.
