n-Decyl-1,1,2,2-d4 alcohol
| Catalog Number |
ACM57367972-1 |
| CAS |
57367-97-2 |
| Structure |
 |
| Synonyms |
Decan-1,1,2,2-D4-1-Ol |
| IUPAC Name |
1,1,2,2-tetradeuteriodecan-1-ol |
| Molecular Weight |
162.31 |
| Molecular Formula |
C10H18D4O |
| InChI |
InChI=1S/C10H22O/c1-2-3-4-5-6-7-8-9-10-11/h11H,2-10H2,1H3/i9D2,10D2 |
| InChI Key |
MWKFXSUHUHTGQN-YQUBHJMPSA-N |
| Chemical Formula |
CH3(CH2)7CD2CD2OH |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])(CCCCCCCC)C([2H])([2H])O |
| Isotopic Enrichment |
99 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
112-30-1 |
| Unlabeled Synonyms |
1-Decanol; Capric alcohol; Decylic alcohol; Nonylcarbinol |
Please kindly note that our products and services are for research use only.
